ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7198 CAS 1246088-45-8



TERT-BUTYL (1-PIVALOYL-2,3-DIHYDRO-1H-PYRIDO[2,3-B][1,4]OXAZIN-6-YL)CARBAMATE
CAS 1246088-45-8
ID 7198

Molecular Formula   C17H25N3O4
Molecular Weight     335.404
SmileCode               CC(C)(C)C(=O)N1CCOC2=C1C=CC(=N2)NC(=O)OC(C)(C)C

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com