ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7202 CAS 1246088-49-2



5-CHLORO-1H-PYRROLO[2,3-B]PYRIDINE-6-CARBOXYLIC ACID
CAS 1246088-49-2
ID 7202

Molecular Formula   C8H5ClN2O2
Molecular Weight     196.590
SmileCode               C1=CNC2=NC(=C(C=C21)Cl)C(=O)O

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com