ID 7203 CAS 1246088-50-5

CAS 1246088-50-5
ID 7203

Molecular Formula   C15H13BrN2O2S
Molecular Weight     365.245
SmileCode               CCC1=CC2=CC(=CN=C2N1S(=O)(=O)C3=CC=CC=C3)Br

Quantity | Price        5g | 3360 USD
Availability               Typically in stock

Inquiry : contact[at]