ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7209 CAS 1246088-56-1



5-FLUORO-1H-PYRROLO[2,3-B]PYRIDINE-6-CARBOXYLIC ACID
CAS 1246088-56-1
ID 7209

Molecular Formula   C8H5FN2O2
Molecular Weight     180.138
SmileCode               C1=CNC2=NC(=C(C=C21)F)C(=O)O

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com