ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7210 CAS 1246088-57-2



4-IODO-1,5-NAPHTHYRIDIN-3-OL
CAS 1246088-57-2
ID 7210

Molecular Formula   C8H5IN2O
Molecular Weight     272.045
SmileCode               C1=CNC2=C(C(=O)C=NC2=C1)I

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com