ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7213 CAS 1246088-60-7



5-FLUORO-1H-PYRROLO[2,3-B]PYRIDINE-6-CARBALDEHYDE
CAS 1246088-60-7
ID 7213

Molecular Formula   C8H5FN2O
Molecular Weight     164.139
SmileCode               C1=CNC2=NC(=C(C=C21)F)C=O

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com