ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7215 CAS 1246088-62-9



1-(1,5-NAPHTHYRIDIN-3-YL)ETHANONE
CAS 1246088-62-9
ID 7215

Molecular Formula   C10H8N2O
Molecular Weight     172.187
SmileCode               CC(=O)C1=CC2=C(C=CC=N2)N=C1

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com