ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7218 CAS 1246088-65-2



2,3-DIIODO-5-METHYL-1-(PHENYLSULFONYL)-1H-PYRROLO[2,3-B]PYRIDINE
CAS 1246088-65-2
ID 7218

Molecular Formula   C14H10I2N2O2S
Molecular Weight     524.115
SmileCode               CC1=CN=C2C(=C1)C(=C(N2S(=O)(=O)C3=CC=CC=C3)I)I

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com