ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7219 CAS 1246088-66-3



3-ALLYL-1,5-NAPHTHYRIDINE
CAS 1246088-66-3
ID 7219

Molecular Formula   C11H10N2
Molecular Weight     170.215
SmileCode               C=CCC1=CC2=C(C=CC=N2)N=C1

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com