ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7220 CAS 1246088-67-4



3-((TRIMETHYLSILYL)ETHYNYL)-1,5-NAPHTHYRIDINE
CAS 1246088-67-4
ID 7220

Molecular Formula   C13H14N2Si
Molecular Weight     226.354
SmileCode               C[Si](C)(C)C#CC1=CC2=C(C=CC=N2)N=C1

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com