ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7222 CAS 1246090-95-8



(E)-METHYL 3-(6-CYANO-5-FLUOROPYRIDIN-3-YL)ACRYLATE
CAS 1246090-95-8
ID 7222

Molecular Formula   C10H7FN2O2
Molecular Weight     206.176
SmileCode               COC(=O)C=CC1=CC(=C(N=C1)C#N)F

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com