ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7223 CAS 1246090-99-2



(E)-2,3-DIHYDRO-[1,4]DIOXINO[2,3-B]PYRIDINE-8-CARBALDEHYDE OXIME
CAS 1246090-99-2
ID 7223

Molecular Formula   C8H8N2O3
Molecular Weight     180.163
SmileCode               C1COC2=C(O1)C(=CN=O)C=CN2

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com