ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7224 CAS 1247726-68-6



5-METHOXY-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)NICOTINONITRILE
CAS 1247726-68-6
ID 7224

Molecular Formula   C13H17BN2O3
Molecular Weight     260.100
SmileCode               B1(OC(C(O1)(C)C)(C)C)C2=C(C=NC=C2C#N)OC

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com