ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7225 CAS 1247726-85-7



6-BROMO-2-CHLORO-3-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PYRIDINE
CAS 1247726-85-7
ID 7225

Molecular Formula   C11H14BBrClNO2
Molecular Weight     318.402
SmileCode               B1(OC(C(O1)(C)C)(C)C)C2=C(N=C(C=C2)Br)Cl

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com