ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7227 CAS 1256818-31-1



2,3-DIHYDRO-[1,4]DIOXINO[2,3-B]PYRIDINE-7-CARBOXYLIC ACID
CAS 1256818-31-1
ID 7227

Molecular Formula   C8H7NO4
Molecular Weight     181.147
SmileCode               C1COC2=C(O1)C=C(C=N2)C(=O)O

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com