ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7228 CAS 1257554-02-1



3-METHYL-6-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)-3H-IMIDAZO[4,5-B]PYRIDINE
CAS 1257554-02-1
ID 7228

Molecular Formula   C13H18BN3O2
Molecular Weight     259.116
SmileCode               B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(N=C2)N(C=N3)C

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com