ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7229 CAS 125867-19-8



N-(2-METHOXYPYRIDIN-3-YL)PIVALAMIDE
CAS 125867-19-8
ID 7229

Molecular Formula   C11H16N2O2
Molecular Weight     208.261
SmileCode               CC(C)(C)C(=O)NC1=C(N=CC=C1)OC

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com