ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7231 CAS 1260382-91-9



5-CHLORO-1H-PYRROLO[2,3-B]PYRIDINE-6-CARBALDEHYDE
CAS 1260382-91-9
ID 7231

Molecular Formula   C8H5ClN2O
Molecular Weight     180.591
SmileCode               C1=CNC2=NC(=C(C=C21)Cl)C=O

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com