ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7235 CAS 1261365-40-5



4-(DIMETHOXYMETHYL)-5-(TRIFLUOROMETHYL)-1H-PYRROLO[2,3-B]PYRIDINE
CAS 1261365-40-5
ID 7235

Molecular Formula   C11H11F3N2O2
Molecular Weight     260.216
SmileCode               COC(C1=C2C=CNC2=NC=C1C(F)(F)F)OC

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com