ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7237 CAS 1261365-46-1



N-(3-FORMYL-5-(TRIFLUOROMETHYL)PYRIDIN-2-YL)PIVALAMIDE
CAS 1261365-46-1
ID 7237

Molecular Formula   C12H13F3N2O2
Molecular Weight     274.243
SmileCode               CC(C)(C)C(=O)NC1=NC=C(C=C1C=O)C(F)(F)F

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com