ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7240 CAS 1261365-49-4



TERT-BUTYL (3-ALLYL-4-METHOXYPYRIDIN-2-YL)CARBAMATE
CAS 1261365-49-4
ID 7240

Molecular Formula   C14H20N2O3
Molecular Weight     264.325
SmileCode               CC(C)(C)OC(=O)NC1=NC=CC(=C1CC=C)OC

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com