ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7242 CAS 1261365-51-8



3-IODO-5-(TRIFLUOROMETHYL)PYRIDIN-2-YL TRIFLUOROMETHANESULFONATE
CAS 1261365-51-8
ID 7242

Molecular Formula   C7H2F6INO3S
Molecular Weight     421.052
SmileCode               C1=C(C=NC(=C1I)OS(=O)(=O)C(F)(F)F)C(F)(F)F

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com