ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7243 CAS 1261365-55-2



4-IODO-1,5-NAPHTHYRIDIN-3-AMINE
CAS 1261365-55-2
ID 7243

Molecular Formula   C8H6IN3
Molecular Weight     271.061
SmileCode               C1=CC2=NC=C(C(=C2N=C1)I)N

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com