ID 7247 CAS 1261365-59-6

CAS 1261365-59-6
ID 7247

Molecular Formula   C11H13F3N2Si
Molecular Weight     258.319
SmileCode               C[Si](C)(C)C1=C2C=CNC2=NC=C1C(F)(F)F

Quantity | Price        5g | 3360 USD
Availability               Typically in stock

Inquiry : contact[at]