ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7248 CAS 1261365-60-9



5-(TRIFLUOROMETHYL)-4-((TRIMETHYLSILYL)ETHYNYL)-1H-PYRROLO[2,3-B]PYRIDINE
CAS 1261365-60-9
ID 7248

Molecular Formula   C13H13F3N2Si
Molecular Weight     282.341
SmileCode               C[Si](C)(C)C#CC1=C2C=CNC2=NC=C1C(F)(F)F

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com