ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7251 CAS 1261365-63-2



METHYL 7-TOSYL-7H-PYRROLO[2,3-D]PYRIMIDINE-4-CARBOXYLATE
CAS 1261365-63-2
ID 7251

Molecular Formula   C15H13N3O4S
Molecular Weight     331.346
SmileCode               CC1=CC=C(C=C1)S(=O)(=O)N2C=CC3=C(N=CN=C32)C(=O)OC

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com