ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7254 CAS 1261365-66-5



3-(DIMETHOXYMETHYL)-1,5-NAPHTHYRIDINE
CAS 1261365-66-5
ID 7254

Molecular Formula   C11H12N2O2
Molecular Weight     204.229
SmileCode               COC(C1=CC2=C(C=CC=N2)N=C1)OC

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com