ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7256 CAS 1261365-74-5



2-METHYL-6-(TRIFLUOROMETHYL)-1,8-NAPHTHYRIDINE
CAS 1261365-74-5
ID 7256

Molecular Formula   C10H7F3N2
Molecular Weight     212.175
SmileCode               CC1=NC2=NC=C(C=C2C=C1)C(F)(F)F

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com