ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7257 CAS 1261365-76-7



METHYL 1,5-NAPHTHYRIDINE-3-CARBOXYLATE
CAS 1261365-76-7
ID 7257

Molecular Formula   C10H8N2O2
Molecular Weight     188.186
SmileCode               COC(=O)C1=CC2=C(C=CC=N2)N=C1

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com