ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7258 CAS 1261365-77-8



3-(TRIFLUOROMETHYL)-1,8-NAPHTHYRIDINE
CAS 1261365-77-8
ID 7258

Molecular Formula   C9H5F3N2
Molecular Weight     198.148
SmileCode               C1=CC2=CC(=CN=C2N=C1)C(F)(F)F

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com