ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7259 CAS 1261365-81-4



4-IODO-2,3-DIMETHOXY-5-(TRIFLUOROMETHYL)PYRIDINE
CAS 1261365-81-4
ID 7259

Molecular Formula   C8H7F3INO2
Molecular Weight     333.049
SmileCode               COC1=C(C(=CN=C1OC)C(F)(F)F)I

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com