ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7261 CAS 1261365-83-6



5-BROMO-2-(DIMETHOXYMETHYL)-1-(PHENYLSULFONYL)-1H-PYRROLO[2,3-B]PYRIDINE
CAS 1261365-83-6
ID 7261

Molecular Formula   C16H15BrN2O4S
Molecular Weight     411.270
SmileCode               COC(C1=CC2=CC(=CN=C2N1S(=O)(=O)C3=CC=CC=C3)Br)OC

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com