ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7262 CAS 1261365-84-7



6-IODO-3,4-DIHYDRO-2H-PYRANO[3,2-B]PYRIDINE-8-CARBALDEHYDE
CAS 1261365-84-7
ID 7262

Molecular Formula   C9H8INO2
Molecular Weight     289.072
SmileCode               C1CC2=C(C(=CC(=N2)I)C=O)OC1

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com