ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7263 CAS 1261365-85-8



5-BROMO-3-IODOPYRIDIN-2-YL TRIFLUOROMETHANESULFONATE
CAS 1261365-85-8
ID 7263

Molecular Formula   C6H2BrF3INO3S
Molecular Weight     431.950
SmileCode               C1=C(C=NC(=C1I)OS(=O)(=O)C(F)(F)F)Br

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com